C16H22O3 — CID 135053888
methyl (3aR,8aR)-6-acetyl-8a-methyl-4-methylidene-1,2,3,3a,5,8-hexahydroazulene-2-carboxylate (PubChem CID 135053888) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (3aR,8aR)-6-acetyl-8a-methyl-4-methylidene-1,2,3,3a,5,8-hexahydroazulene-2-carboxylate.
| Compound Name | methyl (3aR,8aR)-6-acetyl-8a-methyl-4-methylidene-1,2,3,3a,5,8-hexahydroazulene-2-carboxylate |
|---|---|
| PubChem CID | 135053888 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (3aR,8aR)-6-acetyl-8a-methyl-4-methylidene-1,2,3,3a,5,8-hexahydroazulene-2-carboxylate |
| SMILES | C=C1CC(C(C)=O)=CC[C@]2(C)CC(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C16H22O3/c1-10-7-12(11(2)17)5-6-16(3)9-13(8-14(10)16)15(18)19-4/h5,13-14H,1,6-9H2,2-4H3/t13?,14-,16-/m1/s1 |
| InChIKey | YDTGMHQXNVXORX-IGLHTZBQSA-N |
| XLogP | 3.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|