C20H32O2 — CID 10494747
(1S,3aS,8aR)-1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,6-dimethyl-1,2,3,4,8,8a-hexahydroazulen-5-one (PubChem CID 10494747) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3aS,8aR)-1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,6-dimethyl-1,2,3,4,8,8a-hexahydroazulen-5-one.
| Compound Name | (1S,3aS,8aR)-1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,6-dimethyl-1,2,3,4,8,8a-hexahydroazulen-5-one |
|---|---|
| PubChem CID | 10494747 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3aS,8aR)-1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,6-dimethyl-1,2,3,4,8,8a-hexahydroazulen-5-one |
| SMILES | CC(C)=CCCC(C)(O)[C@H]1CC[C@@]2(C)CC(=O)C(C)=CC[C@H]12 |
| InChI | InChI=1S/C20H32O2/c1-14(2)7-6-11-20(5,22)17-10-12-19(4)13-18(21)15(3)8-9-16(17)19/h7-8,16-17,22H,6,9-13H2,1-5H3/t16-,17+,19+,20?/m1/s1 |
| InChIKey | CTLMPKXXSYQROQ-DTDSIWIMSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|