C21H24FNO3 — CID 135054171
tert-butyl (2S)-2-benzamido-3-(2-fluorophenyl)-2-methylpropanoate (PubChem CID 135054171) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-benzamido-3-(2-fluorophenyl)-2-methylpropanoate.
| Compound Name | tert-butyl (2S)-2-benzamido-3-(2-fluorophenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 135054171 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl (2S)-2-benzamido-3-(2-fluorophenyl)-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1ccccc1F)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24FNO3/c1-20(2,3)26-19(25)21(4,14-16-12-8-9-13-17(16)22)23-18(24)15-10-6-5-7-11-15/h5-13H,14H2,1-4H3,(H,23,24)/t21-/m0/s1 |
| InChIKey | STOLDKZGLKSLSA-NRFANRHFSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |