C26H33NO6 — CID 135054508
ditert-butyl (1R,2S,5R,6S)-4-formyl-2,5-dimethyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate (PubChem CID 135054508) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is ditert-butyl (1R,2S,5R,6S)-4-formyl-2,5-dimethyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate.
| Compound Name | ditert-butyl (1R,2S,5R,6S)-4-formyl-2,5-dimethyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 135054508 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | ditert-butyl (1R,2S,5R,6S)-4-formyl-2,5-dimethyl-2'-oxospiro[cyclohex-3-ene-6,3'-indole]-1,1'-dicarboxylate |
| SMILES | C[C@@H]1C(C=O)=C[C@H](C)[C@@H](C(=O)OC(C)(C)C)[C@@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C26H33NO6/c1-15-13-17(14-28)16(2)26(20(15)21(29)32-24(3,4)5)18-11-9-10-12-19(18)27(22(26)30)23(31)33-25(6,7)8/h9-16,20H,1-8H3/t15-,16+,20-,26+/m0/s1 |
| InChIKey | UJCZVXVCSXKHPN-KPBNMVKASA-N |
| XLogP | 4.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|