C18H30O4 — CID 135054622
ethyl 4-[(2S)-2-(2,2-dimethylpropanoyloxymethyl)cyclopentyl]-2-methylidenebutanoate (PubChem CID 135054622) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-(2,2-dimethylpropanoyloxymethyl)cyclopentyl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(2S)-2-(2,2-dimethylpropanoyloxymethyl)cyclopentyl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 135054622 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl 4-[(2S)-2-(2,2-dimethylpropanoyloxymethyl)cyclopentyl]-2-methylidenebutanoate |
| SMILES | C=C(CCC1CCC[C@@H]1COC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H30O4/c1-6-21-16(19)13(2)10-11-14-8-7-9-15(14)12-22-17(20)18(3,4)5/h14-15H,2,6-12H2,1,3-5H3/t14?,15-/m1/s1 |
| InChIKey | ZPMKXAMBHJMCHL-YSSOQSIOSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|