C19H30O3 — CID 102391718
[2-methylidene-4-[(1S,5S)-1-methyl-2-oxo-5-prop-2-enylcyclopentyl]butyl] 2,2-dimethylpropanoate (PubChem CID 102391718) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is [2-methylidene-4-[(1S,5S)-1-methyl-2-oxo-5-prop-2-enylcyclopentyl]butyl] 2,2-dimethylpropanoate.
| Compound Name | [2-methylidene-4-[(1S,5S)-1-methyl-2-oxo-5-prop-2-enylcyclopentyl]butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102391718 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | [2-methylidene-4-[(1S,5S)-1-methyl-2-oxo-5-prop-2-enylcyclopentyl]butyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H]1CCC(=O)[C@@]1(C)CCC(=C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30O3/c1-7-8-15-9-10-16(20)19(15,6)12-11-14(2)13-22-17(21)18(3,4)5/h7,15H,1-2,8-13H2,3-6H3/t15-,19+/m1/s1 |
| InChIKey | IEVHHPZOPPDFPF-BEFAXECRSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|