C13H26O3Si — CID 135055204
(2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-4-one (PubChem CID 135055204) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-4-one.
| Compound Name | (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-4-one |
|---|---|
| PubChem CID | 135055204 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (2R,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyloxan-4-one |
| SMILES | C[C@H]1C(=O)CCO[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-10-11(14)7-8-15-12(10)9-16-17(5,6)13(2,3)4/h10,12H,7-9H2,1-6H3/t10-,12-/m0/s1 |
| InChIKey | GTEDPONACFXGIT-JQWIXIFHSA-N |
| XLogP | 3.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|