C14H28O3Si — CID 135075552
(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyloxan-4-one (PubChem CID 135075552) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is (2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyloxan-4-one.
| Compound Name | (2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyloxan-4-one |
|---|---|
| PubChem CID | 135075552 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethyloxan-4-one |
| SMILES | C[C@@H]1C(=O)C[C@H](C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-10-8-12(15)11(2)13(17-10)9-16-18(6,7)14(3,4)5/h10-11,13H,8-9H2,1-7H3/t10-,11+,13+/m0/s1 |
| InChIKey | JUDIVFKFWRXUJT-DMDPSCGWSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|