C21H21BrN2O5 — CID 135055465
methyl 6-bromo-3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-1H-indole-5-carboxylate (PubChem CID 135055465) has the molecular formula C21H21BrN2O5 and a molecular weight of 461.31 g/mol. Its IUPAC name is methyl 6-bromo-3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-1H-indole-5-carboxylate.
| Compound Name | methyl 6-bromo-3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 135055465 |
| Molecular Formula | C21H21BrN2O5 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | methyl 6-bromo-3-[2-ethoxy-1-(4-methoxyanilino)-2-oxoethyl]-1H-indole-5-carboxylate |
| SMILES | CCOC(=O)C(Nc1ccc(OC)cc1)c1c[nH]c2cc(Br)c(C(=O)OC)cc12 |
| InChI | InChI=1S/C21H21BrN2O5/c1-4-29-21(26)19(24-12-5-7-13(27-2)8-6-12)16-11-23-18-10-17(22)15(9-14(16)18)20(25)28-3/h5-11,19,23-24H,4H2,1-3H3 |
| InChIKey | BKWVNNLFFMRJEM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|