C8H10Cl2O3 — CID 135055930
(3E,4R)-3-(1-chloro-2-methoxyethylidene)-4-(chloromethyl)oxolan-2-one (PubChem CID 135055930) has the molecular formula C8H10Cl2O3 and a molecular weight of 225.07 g/mol. Its IUPAC name is (3E,4R)-3-(1-chloro-2-methoxyethylidene)-4-(chloromethyl)oxolan-2-one.
| Compound Name | (3E,4R)-3-(1-chloro-2-methoxyethylidene)-4-(chloromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 135055930 |
| Molecular Formula | C8H10Cl2O3 |
| Molecular Weight | 225.07 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | (3E,4R)-3-(1-chloro-2-methoxyethylidene)-4-(chloromethyl)oxolan-2-one |
| SMILES | COC/C(Cl)=C1\C(=O)OC[C@@H]1CCl |
| InChI | InChI=1S/C8H10Cl2O3/c1-12-4-6(10)7-5(2-9)3-13-8(7)11/h5H,2-4H2,1H3/b7-6+/t5-/m0/s1 |
| InChIKey | OVUNXSSQXXVDGN-UNPHKUQDSA-N |
| XLogP | 1.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.07 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|