C7H8Cl2O2 — CID 135060044
(3E,4R)-3-(1-chloroethylidene)-4-(chloromethyl)oxolan-2-one (PubChem CID 135060044) has the molecular formula C7H8Cl2O2 and a molecular weight of 195.04 g/mol. Its IUPAC name is (3E,4R)-3-(1-chloroethylidene)-4-(chloromethyl)oxolan-2-one.
| Compound Name | (3E,4R)-3-(1-chloroethylidene)-4-(chloromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 135060044 |
| Molecular Formula | C7H8Cl2O2 |
| Molecular Weight | 195.04 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | (3E,4R)-3-(1-chloroethylidene)-4-(chloromethyl)oxolan-2-one |
| SMILES | C/C(Cl)=C1\C(=O)OC[C@@H]1CCl |
| InChI | InChI=1S/C7H8Cl2O2/c1-4(9)6-5(2-8)3-11-7(6)10/h5H,2-3H2,1H3/b6-4+/t5-/m0/s1 |
| InChIKey | WRNQVDMIXFYAGT-WHEKYOLUSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|