C22H22O4 — CID 135056082
ethyl (1S,5S)-1-ethyl-3-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1-carboxylate (PubChem CID 135056082) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is ethyl (1S,5S)-1-ethyl-3-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,5S)-1-ethyl-3-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 135056082 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | ethyl (1S,5S)-1-ethyl-3-hydroxy-2-oxo-4,5-diphenylcyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(CC)C(=O)C(O)=C(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H22O4/c1-3-22(21(25)26-4-2)18(16-13-9-6-10-14-16)17(19(23)20(22)24)15-11-7-5-8-12-15/h5-14,18,23H,3-4H2,1-2H3/t18-,22-/m0/s1 |
| InChIKey | XSGNBTIHFZBDQS-AVRDEDQJSA-N |
| XLogP | 4.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|