About [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride
[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride (PubChem CID 135056424) has the molecular formula C6H15ClFN
and a molecular weight of 155.64 g/mol. Its IUPAC name is [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride.
Analyze [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride?
The IUPAC name of [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride (CID 135056424) is [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride.
What is the SMILES notation for [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride?
The canonical SMILES for [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride is CC(C)(C)[C@H]([NH3+])CF.[Cl-].
What is the InChIKey of [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride?
The InChIKey is QNPFAJPALFGGCY-NUBCRITNSA-N. The full InChI is InChI=1S/C6H14FN.ClH/c1-6(2,3)5(8)4-7;/h5H,4,8H2,1-3H3;1H/t5-;/m1./s1.
What are the key properties of [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride?
[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride has a molecular weight of 155.64 g/mol, XLogP of -2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-fluoro-3,3-dimethylbutan-2-yl]azanium chloride is sourced from PubChem (CID 135056424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).