C12H28O — CID 158433518
2,2-dimethylpropane;(2R)-2,3,3-trimethylbutan-1-ol (PubChem CID 158433518) has the molecular formula C12H28O and a molecular weight of 188.35 g/mol. Its IUPAC name is 2,2-dimethylpropane;(2R)-2,3,3-trimethylbutan-1-ol.
| Compound Name | 2,2-dimethylpropane;(2R)-2,3,3-trimethylbutan-1-ol |
|---|---|
| PubChem CID | 158433518 |
| Molecular Formula | C12H28O |
| Molecular Weight | 188.35 g/mol |
| Exact Mass | 188.21 |
| IUPAC Name | 2,2-dimethylpropane;(2R)-2,3,3-trimethylbutan-1-ol |
| SMILES | CC(C)(C)C.C[C@@H](CO)C(C)(C)C |
| InChI | InChI=1S/C7H16O.C5H12/c1-6(5-8)7(2,3)4;1-5(2,3)4/h6,8H,5H2,1-4H3;1-4H3/t6-;/m0./s1 |
| InChIKey | HBYFVVAIVGOLCS-RGMNGODLSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |