C9H20O4 — CID 140988285
2,3,5-trimethylhexane-1,3,4,5-tetrol (PubChem CID 140988285) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2,3,5-trimethylhexane-1,3,4,5-tetrol.
| Compound Name | 2,3,5-trimethylhexane-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 140988285 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2,3,5-trimethylhexane-1,3,4,5-tetrol |
| SMILES | CC(CO)C(C)(O)C(O)C(C)(C)O |
| InChI | InChI=1S/C9H20O4/c1-6(5-10)9(4,13)7(11)8(2,3)12/h6-7,10-13H,5H2,1-4H3 |
| InChIKey | NIIJZYQAQFSHGW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |