C13H20O2 — CID 141303157
2,3-dimethyl-4-phenylpentane-1,3-diol (PubChem CID 141303157) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,3-dimethyl-4-phenylpentane-1,3-diol.
| Compound Name | 2,3-dimethyl-4-phenylpentane-1,3-diol |
|---|---|
| PubChem CID | 141303157 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2,3-dimethyl-4-phenylpentane-1,3-diol |
| SMILES | CC(CO)C(C)(O)C(C)c1ccccc1 |
| InChI | InChI=1S/C13H20O2/c1-10(9-14)13(3,15)11(2)12-7-5-4-6-8-12/h4-8,10-11,14-15H,9H2,1-3H3 |
| InChIKey | UDNBDPOBCUAIJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |