About 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol
3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol (PubChem CID 87369520) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol |
| PubChem CID | 87369520 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol |
| SMILES | CC(CO)C(C)(C)OC(C)(C)C(C)CO |
| InChI | InChI=1S/C12H26O3/c1-9(7-13)11(3,4)15-12(5,6)10(2)8-14/h9-10,13-14H,7-8H2,1-6H3 |
| InChIKey | CMWVOMXMDUNMRC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol?
The IUPAC name of 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol (CID 87369520) is 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol.
What is the SMILES notation for 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol?
The canonical SMILES for 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol is CC(CO)C(C)(C)OC(C)(C)C(C)CO.
What is the InChIKey of 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol?
The InChIKey is CMWVOMXMDUNMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3/c1-9(7-13)11(3,4)15-12(5,6)10(2)8-14/h9-10,13-14H,7-8H2,1-6H3.
What are the key properties of 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol?
3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol has a molecular weight of 218.34 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,3-dimethylbutan-1-ol is sourced from PubChem (CID 87369520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).