About 1-hydroxypropan-2-olate
1-hydroxypropan-2-olate (PubChem CID 21225559) has the molecular formula C3H7O2-
and a molecular weight of 75.09 g/mol. Its IUPAC name is 1-hydroxypropan-2-olate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-olate |
| PubChem CID | 21225559 |
| Molecular Formula | C3H7O2- |
| Molecular Weight | 75.09 g/mol |
| Exact Mass | 75.05 |
| IUPAC Name | 1-hydroxypropan-2-olate |
| SMILES | CC([O-])CO |
| InChI | InChI=1S/C3H7O2/c1-3(5)2-4/h3-4H,2H2,1H3/q-1 |
| InChIKey | YFTXVEJQYXIXDH-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 75.09 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxypropan-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-olate?
The IUPAC name of 1-hydroxypropan-2-olate (CID 21225559) is 1-hydroxypropan-2-olate.
What is the SMILES notation for 1-hydroxypropan-2-olate?
The canonical SMILES for 1-hydroxypropan-2-olate is CC([O-])CO.
What is the InChIKey of 1-hydroxypropan-2-olate?
The InChIKey is YFTXVEJQYXIXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O2/c1-3(5)2-4/h3-4H,2H2,1H3/q-1.
What are the key properties of 1-hydroxypropan-2-olate?
1-hydroxypropan-2-olate has a molecular weight of 75.09 g/mol, XLogP of -1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-olate is sourced from PubChem (CID 21225559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).