C11H14BrF2NSi — CID 135057207
(E)-1-(4-bromophenyl)-2,2-difluoro-N-trimethylsilylethanimine (PubChem CID 135057207) has the molecular formula C11H14BrF2NSi and a molecular weight of 306.23 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2,2-difluoro-N-trimethylsilylethanimine.
| Compound Name | (E)-1-(4-bromophenyl)-2,2-difluoro-N-trimethylsilylethanimine |
|---|---|
| PubChem CID | 135057207 |
| Molecular Formula | C11H14BrF2NSi |
| Molecular Weight | 306.23 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2,2-difluoro-N-trimethylsilylethanimine |
| SMILES | C[Si](C)(C)/N=C(\c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C11H14BrF2NSi/c1-16(2,3)15-10(11(13)14)8-4-6-9(12)7-5-8/h4-7,11H,1-3H3/b15-10+ |
| InChIKey | ZJBKPKRQZMMNHE-XNTDXEJSSA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.23 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|