C11H13BrF3NSi — CID 58611153
(E)-1-(4-bromophenyl)-2,2,2-trifluoro-N-trimethylsilylethanimine (PubChem CID 58611153) has the molecular formula C11H13BrF3NSi and a molecular weight of 324.22 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-2,2,2-trifluoro-N-trimethylsilylethanimine.
| Compound Name | (E)-1-(4-bromophenyl)-2,2,2-trifluoro-N-trimethylsilylethanimine |
|---|---|
| PubChem CID | 58611153 |
| Molecular Formula | C11H13BrF3NSi |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (E)-1-(4-bromophenyl)-2,2,2-trifluoro-N-trimethylsilylethanimine |
| SMILES | C[Si](C)(C)/N=C(\c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NSi/c1-17(2,3)16-10(11(13,14)15)8-4-6-9(12)7-5-8/h4-7H,1-3H3/b16-10+ |
| InChIKey | YADUFKIZOVLONC-MHWRWJLKSA-N |
| XLogP | 4.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|