C11H14F3NSi — CID 76837331
2,2,2-trifluoro-1-phenyl-N-trimethylsilylethanimine (PubChem CID 76837331) has the molecular formula C11H14F3NSi and a molecular weight of 245.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-phenyl-N-trimethylsilylethanimine.
| Compound Name | 2,2,2-trifluoro-1-phenyl-N-trimethylsilylethanimine |
|---|---|
| PubChem CID | 76837331 |
| Molecular Formula | C11H14F3NSi |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2,2,2-trifluoro-1-phenyl-N-trimethylsilylethanimine |
| SMILES | C[Si](C)(C)N=C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NSi/c1-16(2,3)15-10(11(12,13)14)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | GMOKXLCQVOLFTM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|