C8H5BrF3N — CID 12164757
1-(3-Bromophenyl)-2,2,2-trifluoroethanimine (PubChem CID 12164757) has the molecular formula C8H5BrF3N and a molecular weight of 252.03 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(3-Bromophenyl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 12164757 |
| Molecular Formula | C8H5BrF3N |
| Molecular Weight | 252.03 g/mol |
| Exact Mass | 250.96 |
| IUPAC Name | 1-(3-bromophenyl)-2,2,2-trifluoroethanimine |
| SMILES | C1=CC(=CC(=C1)Br)C(=N)C(F)(F)F |
| InChI | InChI=1S/C8H5BrF3N/c9-6-3-1-2-5(4-6)7(13)8(10,11)12/h1-4,13H |
| InChIKey | OXTQJKZSFXCSLD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 202 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.03 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|