C12H24Si — CID 135057231
[(E)-2-[(1R,2R)-2-butylcyclopropyl]ethenyl]-trimethylsilane (PubChem CID 135057231) has the molecular formula C12H24Si and a molecular weight of 196.41 g/mol. Its IUPAC name is [(E)-2-[(1R,2R)-2-butylcyclopropyl]ethenyl]-trimethylsilane.
| Compound Name | [(E)-2-[(1R,2R)-2-butylcyclopropyl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 135057231 |
| Molecular Formula | C12H24Si |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(E)-2-[(1R,2R)-2-butylcyclopropyl]ethenyl]-trimethylsilane |
| SMILES | CCCC[C@@H]1C[C@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si/c1-5-6-7-11-10-12(11)8-9-13(2,3)4/h8-9,11-12H,5-7,10H2,1-4H3/b9-8+/t11-,12-/m1/s1 |
| InChIKey | WAMDGVYDOCOPDK-SVKHLYGUSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|