About 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+)
2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) (PubChem CID 135008031) has the molecular formula C15H29ClSiZn
and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+).
Molecular Properties
| Compound Name | 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) |
| PubChem CID | 135008031 |
| Molecular Formula | C15H29ClSiZn |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) |
| SMILES | C=CC(C)/C(=[C-]/[Si](C)(C)C)CCCCCC.Cl[Zn+] |
| InChI | InChI=1S/C15H29Si.ClH.Zn/c1-7-9-10-11-12-15(14(3)8-2)13-16(4,5)6;;/h8,14H,2,7,9-12H2,1,3-6H3;1H;/q-1;;+2/p-1 |
| InChIKey | RXFFXNASIZMGSL-UHFFFAOYSA-M |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+)?
The IUPAC name of 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) (CID 135008031) is 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+).
What is the SMILES notation for 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+)?
The canonical SMILES for 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) is C=CC(C)/C(=[C-]/[Si](C)(C)C)CCCCCC.Cl[Zn+].
What is the InChIKey of 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+)?
The InChIKey is RXFFXNASIZMGSL-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H29Si.ClH.Zn/c1-7-9-10-11-12-15(14(3)8-2)13-16(4,5)6;;/h8,14H,2,7,9-12H2,1,3-6H3;1H;/q-1;;+2/p-1.
What are the key properties of 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+)?
2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) has a molecular weight of 338.33 g/mol, XLogP of 6.07, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-en-2-yloct-1-enyl(trimethyl)silane;chlorozinc(1+) is sourced from PubChem (CID 135008031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).