C15H32Si — CID 102273768
tert-butyl-dimethyl-[(E,3R)-3-methyloct-1-enyl]silane (PubChem CID 102273768) has the molecular formula C15H32Si and a molecular weight of 240.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,3R)-3-methyloct-1-enyl]silane.
| Compound Name | tert-butyl-dimethyl-[(E,3R)-3-methyloct-1-enyl]silane |
|---|---|
| PubChem CID | 102273768 |
| Molecular Formula | C15H32Si |
| Molecular Weight | 240.51 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | tert-butyl-dimethyl-[(E,3R)-3-methyloct-1-enyl]silane |
| SMILES | CCCCC[C@@H](C)/C=C/[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32Si/c1-8-9-10-11-14(2)12-13-16(6,7)15(3,4)5/h12-14H,8-11H2,1-7H3/b13-12+/t14-/m1/s1 |
| InChIKey | GNDUOCDVZNVIFI-XTZCOPOCSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|