C22H44Si — CID 135008059
[(1E)-2-hexyl-3-methyldodeca-1,4-dienyl]-trimethylsilane (PubChem CID 135008059) has the molecular formula C22H44Si and a molecular weight of 336.68 g/mol. Its IUPAC name is [(1E)-2-hexyl-3-methyldodeca-1,4-dienyl]-trimethylsilane.
| Compound Name | [(1E)-2-hexyl-3-methyldodeca-1,4-dienyl]-trimethylsilane |
|---|---|
| PubChem CID | 135008059 |
| Molecular Formula | C22H44Si |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 336.32 |
| IUPAC Name | [(1E)-2-hexyl-3-methyldodeca-1,4-dienyl]-trimethylsilane |
| SMILES | CCCCCCCC=CC(C)/C(=C/[Si](C)(C)C)CCCCCC |
| InChI | InChI=1S/C22H44Si/c1-7-9-11-13-14-15-16-18-21(3)22(20-23(4,5)6)19-17-12-10-8-2/h16,18,20-21H,7-15,17,19H2,1-6H3/b18-16?,22-20+ |
| InChIKey | YIGAIAJSUBJOCC-TXBKAWCXSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|