C23H14F6O4 — CID 135059702
4-methoxycarbonyl-2,6-bis[4-(trifluoromethyl)phenyl]benzoic acid (PubChem CID 135059702) has the molecular formula C23H14F6O4 and a molecular weight of 468.35 g/mol. Its IUPAC name is 4-methoxycarbonyl-2,6-bis[4-(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-methoxycarbonyl-2,6-bis[4-(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 135059702 |
| Molecular Formula | C23H14F6O4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 4-methoxycarbonyl-2,6-bis[4-(trifluoromethyl)phenyl]benzoic acid |
| SMILES | COC(=O)c1cc(-c2ccc(C(F)(F)F)cc2)c(C(=O)O)c(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C23H14F6O4/c1-33-21(32)14-10-17(12-2-6-15(7-3-12)22(24,25)26)19(20(30)31)18(11-14)13-4-8-16(9-5-13)23(27,28)29/h2-11H,1H3,(H,30,31) |
| InChIKey | YHPFMNFQPFCPPP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |