C17H17N3O4 — CID 135060392
ethyl 4-methyl-3,5-dioxo-4,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-8,10(15),11,13-tetraene-7-carboxylate (PubChem CID 135060392) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 4-methyl-3,5-dioxo-4,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-8,10(15),11,13-tetraene-7-carboxylate.
| Compound Name | ethyl 4-methyl-3,5-dioxo-4,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-8,10(15),11,13-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 135060392 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | ethyl 4-methyl-3,5-dioxo-4,14,16-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-8,10(15),11,13-tetraene-7-carboxylate |
| SMILES | CCOC(=O)C1C=C2c3cccnc3NC2C2C(=O)N(C)C(=O)C12 |
| InChI | InChI=1S/C17H17N3O4/c1-3-24-17(23)10-7-9-8-5-4-6-18-14(8)19-13(9)12-11(10)15(21)20(2)16(12)22/h4-7,10-13H,3H2,1-2H3,(H,18,19) |
| InChIKey | ZOVOXFILQHMDMM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|