C30H30O4S — CID 135060930
[5-[(2S,4S,5S)-2,5-diethyl-4-thiophen-3-yl-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate (PubChem CID 135060930) has the molecular formula C30H30O4S and a molecular weight of 486.63 g/mol. Its IUPAC name is [5-[(2S,4S,5S)-2,5-diethyl-4-thiophen-3-yl-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate.
| Compound Name | [5-[(2S,4S,5S)-2,5-diethyl-4-thiophen-3-yl-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate |
|---|---|
| PubChem CID | 135060930 |
| Molecular Formula | C30H30O4S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [5-[(2S,4S,5S)-2,5-diethyl-4-thiophen-3-yl-1,3-dioxolan-4-yl]-2-phenylcyclohexa-1,5-dien-1-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](CC)[C@](C2=CC(OC(=O)c3ccccc3)=C(c3ccccc3)CC2)(c2ccsc2)O1 |
| InChI | InChI=1S/C30H30O4S/c1-3-27-30(24-17-18-35-20-24,34-28(4-2)33-27)23-15-16-25(21-11-7-5-8-12-21)26(19-23)32-29(31)22-13-9-6-10-14-22/h5-14,17-20,27-28H,3-4,15-16H2,1-2H3/t27-,28-,30-/m0/s1 |
| InChIKey | ORAZOIAMYJHGRP-XEVVZDEMSA-N |
| XLogP | 7.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |