C7H14OS2 — CID 135061046
(1S,2S)-2-propan-2-yl-1,3-dithiane 1-oxide (PubChem CID 135061046) has the molecular formula C7H14OS2 and a molecular weight of 178.32 g/mol. Its IUPAC name is (1S,2S)-2-propan-2-yl-1,3-dithiane 1-oxide.
| Compound Name | (1S,2S)-2-propan-2-yl-1,3-dithiane 1-oxide |
|---|---|
| PubChem CID | 135061046 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | (1S,2S)-2-propan-2-yl-1,3-dithiane 1-oxide |
| SMILES | CC(C)[C@H]1SCCC[S@@]1=O |
| InChI | InChI=1S/C7H14OS2/c1-6(2)7-9-4-3-5-10(7)8/h6-7H,3-5H2,1-2H3/t7-,10-/m0/s1 |
| InChIKey | ANWJZNNBUFJAHK-XVKPBYJWSA-N |
| XLogP | 1.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |