C12H25FO2Si — CID 135061402
[(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-fluoro-2-methylcyclopropyl]methanol (PubChem CID 135061402) has the molecular formula C12H25FO2Si and a molecular weight of 248.41 g/mol. Its IUPAC name is [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-fluoro-2-methylcyclopropyl]methanol.
| Compound Name | [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-fluoro-2-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 135061402 |
| Molecular Formula | C12H25FO2Si |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(1R,2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-fluoro-2-methylcyclopropyl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)C[C@]1(F)CO |
| InChI | InChI=1S/C12H25FO2Si/c1-10(2,3)16(5,6)15-9-11(4)7-12(11,13)8-14/h14H,7-9H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | IAEUWMXFMDLYPY-RYUDHWBXSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|