C14H29FO2Si — CID 134947755
[(1S,2S,3S)-2-fluoro-3-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]methanol (PubChem CID 134947755) has the molecular formula C14H29FO2Si and a molecular weight of 276.47 g/mol. Its IUPAC name is [(1S,2S,3S)-2-fluoro-3-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]methanol.
| Compound Name | [(1S,2S,3S)-2-fluoro-3-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 134947755 |
| Molecular Formula | C14H29FO2Si |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | [(1S,2S,3S)-2-fluoro-3-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]methanol |
| SMILES | CC(C)[Si](OC[C@H]1[C@@H](F)[C@@H]1CO)(C(C)C)C(C)C |
| InChI | InChI=1S/C14H29FO2Si/c1-9(2)18(10(3)4,11(5)6)17-8-13-12(7-16)14(13)15/h9-14,16H,7-8H2,1-6H3/t12-,13-,14+/m1/s1 |
| InChIKey | BIEQIUBYSSMYRN-MCIONIFRSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|