C13H30O2Si — CID 10060505
(2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentan-1-ol (PubChem CID 10060505) has the molecular formula C13H30O2Si and a molecular weight of 246.47 g/mol. Its IUPAC name is (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentan-1-ol.
| Compound Name | (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 10060505 |
| Molecular Formula | C13H30O2Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | (2R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentan-1-ol |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](C)CO |
| InChI | InChI=1S/C13H30O2Si/c1-11(9-14)8-12(2)10-15-16(6,7)13(3,4)5/h11-12,14H,8-10H2,1-7H3/t11-,12+/m1/s1 |
| InChIKey | WYEQYFFJMPKOBV-NEPJUHHUSA-N |
| XLogP | 3.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|