C29H25FO6S2 — CID 135061404
4,4-bis(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one (PubChem CID 135061404) has the molecular formula C29H25FO6S2 and a molecular weight of 552.65 g/mol. Its IUPAC name is 4,4-bis(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one.
| Compound Name | 4,4-bis(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 135061404 |
| Molecular Formula | C29H25FO6S2 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4,4-bis(benzenesulfonyl)-4-fluoro-3-(4-methoxyphenyl)-1-phenylbutan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccccc2)C(F)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25FO6S2/c1-36-24-19-17-22(18-20-24)27(21-28(31)23-11-5-2-6-12-23)29(30,37(32,33)25-13-7-3-8-14-25)38(34,35)26-15-9-4-10-16-26/h2-20,27H,21H2,1H3 |
| InChIKey | CHEXVBPXHOORPK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |