C24H39NO4Si — CID 135062660
N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dihydro-2H-pyran-6-yl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine (PubChem CID 135062660) has the molecular formula C24H39NO4Si and a molecular weight of 433.67 g/mol. Its IUPAC name is N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dihydro-2H-pyran-6-yl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine.
| Compound Name | N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dihydro-2H-pyran-6-yl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
|---|---|
| PubChem CID | 135062660 |
| Molecular Formula | C24H39NO4Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-benzyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(3,4-dihydro-2H-pyran-6-yl)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanamine |
| SMILES | CC1(C)OC[C@H](C(C2=CCCCO2)N(Cc2ccccc2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H39NO4Si/c1-23(2,3)30(6,7)29-25(17-19-13-9-8-10-14-19)22(20-15-11-12-16-26-20)21-18-27-24(4,5)28-21/h8-10,13-15,21-22H,11-12,16-18H2,1-7H3/t21-,22?/m1/s1 |
| InChIKey | QKJSXXHDZXFRIB-ZMFCMNQTSA-N |
| XLogP | 5.64 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|