C26H52O3Si3 — CID 135062681
ethyl (2E,4Z)-6,6-bis(triethylsilyl)-4-[(E)-3-trimethylsilylprop-2-enoxy]hexa-2,4-dienoate (PubChem CID 135062681) has the molecular formula C26H52O3Si3 and a molecular weight of 496.96 g/mol. Its IUPAC name is ethyl (2E,4Z)-6,6-bis(triethylsilyl)-4-[(E)-3-trimethylsilylprop-2-enoxy]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-6,6-bis(triethylsilyl)-4-[(E)-3-trimethylsilylprop-2-enoxy]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 135062681 |
| Molecular Formula | C26H52O3Si3 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | ethyl (2E,4Z)-6,6-bis(triethylsilyl)-4-[(E)-3-trimethylsilylprop-2-enoxy]hexa-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C(=C/C([Si](CC)(CC)CC)[Si](CC)(CC)CC)OC/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C26H52O3Si3/c1-11-28-25(27)20-19-24(29-21-18-22-30(8,9)10)23-26(31(12-2,13-3)14-4)32(15-5,16-6)17-7/h18-20,22-23,26H,11-17,21H2,1-10H3/b20-19+,22-18+,24-23- |
| InChIKey | BUONEXZDFPRGAT-CQXOVMFUSA-N |
| XLogP | 8.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|