C25H48O3Si2 — CID 135062670
ethyl (2E,4Z)-4-(2-methylidenebutoxy)-6,6-bis(triethylsilyl)hexa-2,4-dienoate (PubChem CID 135062670) has the molecular formula C25H48O3Si2 and a molecular weight of 452.83 g/mol. Its IUPAC name is ethyl (2E,4Z)-4-(2-methylidenebutoxy)-6,6-bis(triethylsilyl)hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4Z)-4-(2-methylidenebutoxy)-6,6-bis(triethylsilyl)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 135062670 |
| Molecular Formula | C25H48O3Si2 |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | ethyl (2E,4Z)-4-(2-methylidenebutoxy)-6,6-bis(triethylsilyl)hexa-2,4-dienoate |
| SMILES | C=C(CC)COC(=C\C([Si](CC)(CC)CC)[Si](CC)(CC)CC)/C=C/C(=O)OCC |
| InChI | InChI=1S/C25H48O3Si2/c1-10-22(9)21-28-23(18-19-24(26)27-11-2)20-25(29(12-3,13-4)14-5)30(15-6,16-7)17-8/h18-20,25H,9-17,21H2,1-8H3/b19-18+,23-20- |
| InChIKey | XSXOBTZYIUJARJ-BMUZNATDSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|