C20H34O3Si — CID 10689241
ethyl (2E,6E,8E,10Z)-3-methoxy-2-methyl-10-(trimethylsilylmethyl)dodeca-2,6,8,10-tetraenoate (PubChem CID 10689241) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is ethyl (2E,6E,8E,10Z)-3-methoxy-2-methyl-10-(trimethylsilylmethyl)dodeca-2,6,8,10-tetraenoate.
| Compound Name | ethyl (2E,6E,8E,10Z)-3-methoxy-2-methyl-10-(trimethylsilylmethyl)dodeca-2,6,8,10-tetraenoate |
|---|---|
| PubChem CID | 10689241 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | ethyl (2E,6E,8E,10Z)-3-methoxy-2-methyl-10-(trimethylsilylmethyl)dodeca-2,6,8,10-tetraenoate |
| SMILES | C/C=C(/C=C/C=C/CC/C(OC)=C(/C)C(=O)OCC)C[Si](C)(C)C |
| InChI | InChI=1S/C20H34O3Si/c1-8-18(16-24(5,6)7)14-12-10-11-13-15-19(22-4)17(3)20(21)23-9-2/h8,10-12,14H,9,13,15-16H2,1-7H3/b11-10+,14-12+,18-8-,19-17+ |
| InChIKey | LCXJHNXQKKEGCR-MOHMUXAISA-N |
| XLogP | 5.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|