C20H38O3Si — CID 24850677
[(3Z,5E)-1-[tert-butyl(dimethyl)silyl]oxynona-3,5-dien-4-yl] 2,2-dimethylpropanoate (PubChem CID 24850677) has the molecular formula C20H38O3Si and a molecular weight of 354.61 g/mol. Its IUPAC name is [(3Z,5E)-1-[tert-butyl(dimethyl)silyl]oxynona-3,5-dien-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3Z,5E)-1-[tert-butyl(dimethyl)silyl]oxynona-3,5-dien-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 24850677 |
| Molecular Formula | C20H38O3Si |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | [(3Z,5E)-1-[tert-butyl(dimethyl)silyl]oxynona-3,5-dien-4-yl] 2,2-dimethylpropanoate |
| SMILES | CCC/C=C/C(=C/CCO[Si](C)(C)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si/c1-10-11-12-14-17(23-18(21)19(2,3)4)15-13-16-22-24(8,9)20(5,6)7/h12,14-15H,10-11,13,16H2,1-9H3/b14-12+,17-15- |
| InChIKey | GFRKBJXIXJWECE-ZXNBGUBTSA-N |
| XLogP | 6.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|