C25H42O3Si — CID 134903462
ethyl (2E,4E,6E,8E,10E)-3-methyl-13-tri(propan-2-yl)silyloxytrideca-2,4,6,8,10-pentaenoate (PubChem CID 134903462) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E)-3-methyl-13-tri(propan-2-yl)silyloxytrideca-2,4,6,8,10-pentaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E)-3-methyl-13-tri(propan-2-yl)silyloxytrideca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 134903462 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E)-3-methyl-13-tri(propan-2-yl)silyloxytrideca-2,4,6,8,10-pentaenoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C/C=C/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H42O3Si/c1-9-27-25(26)20-24(8)18-16-14-12-10-11-13-15-17-19-28-29(21(2)3,22(4)5)23(6)7/h10-16,18,20-23H,9,17,19H2,1-8H3/b11-10+,14-12+,15-13+,18-16+,24-20+ |
| InChIKey | DLKLYDRPBOKEBI-STLKHUIBSA-N |
| XLogP | 7.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|