C18H32O3Si — CID 102075174
[(2E,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylhexa-2,5-dienyl] 2-methylprop-2-enoate (PubChem CID 102075174) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is [(2E,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylhexa-2,5-dienyl] 2-methylprop-2-enoate.
| Compound Name | [(2E,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylhexa-2,5-dienyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102075174 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(2E,4S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylhexa-2,5-dienyl] 2-methylprop-2-enoate |
| SMILES | C=C[C@@](C)(/C=C/COC(=O)C(=C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O3Si/c1-10-18(7,12-11-13-20-16(19)15(2)3)14-21-22(8,9)17(4,5)6/h10-12H,1-2,13-14H2,3-9H3/b12-11+/t18-/m0/s1 |
| InChIKey | KLRQDSPJOZQSMM-DXRVJIQQSA-N |
| XLogP | 4.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|