C17H26O5Si — CID 11244662
ethyl (E)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxopyran-3-yl]prop-2-enoate (PubChem CID 11244662) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is ethyl (E)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxopyran-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxopyran-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11244662 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl (E)-3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxopyran-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1coc(CO[Si](C)(C)C(C)(C)C)cc1=O |
| InChI | InChI=1S/C17H26O5Si/c1-7-20-16(19)9-8-13-11-21-14(10-15(13)18)12-22-23(5,6)17(2,3)4/h8-11H,7,12H2,1-6H3/b9-8+ |
| InChIKey | OUMLEDVQBZHTCJ-CMDGGOBGSA-N |
| XLogP | 3.74 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|