C17H24O7Si — CID 172818782
4-O-[[5-[tert-butyl(dimethyl)silyl]oxy-4-oxopyran-2-yl]methyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 172818782) has the molecular formula C17H24O7Si and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-O-[[5-[tert-butyl(dimethyl)silyl]oxy-4-oxopyran-2-yl]methyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[[5-[tert-butyl(dimethyl)silyl]oxy-4-oxopyran-2-yl]methyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 172818782 |
| Molecular Formula | C17H24O7Si |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-O-[[5-[tert-butyl(dimethyl)silyl]oxy-4-oxopyran-2-yl]methyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCc1cc(=O)c(O[Si](C)(C)C(C)(C)C)co1 |
| InChI | InChI=1S/C17H24O7Si/c1-17(2,3)25(5,6)24-14-11-22-12(9-13(14)18)10-23-16(20)8-7-15(19)21-4/h7-9,11H,10H2,1-6H3/b8-7+ |
| InChIKey | TYAHZIMITPCAKP-BQYQJAHWSA-N |
| XLogP | 2.80 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|