C16H30O4Si — CID 10519360
ethyl (Z,4S)-4-prop-1-en-2-yloxy-5-triethylsilyloxypent-2-enoate (PubChem CID 10519360) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is ethyl (Z,4S)-4-prop-1-en-2-yloxy-5-triethylsilyloxypent-2-enoate.
| Compound Name | ethyl (Z,4S)-4-prop-1-en-2-yloxy-5-triethylsilyloxypent-2-enoate |
|---|---|
| PubChem CID | 10519360 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | ethyl (Z,4S)-4-prop-1-en-2-yloxy-5-triethylsilyloxypent-2-enoate |
| SMILES | C=C(C)O[C@@H](/C=C\C(=O)OCC)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H30O4Si/c1-7-18-16(17)12-11-15(20-14(5)6)13-19-21(8-2,9-3)10-4/h11-12,15H,5,7-10,13H2,1-4,6H3/b12-11-/t15-/m0/s1 |
| InChIKey | TVVVAECKKCZNCT-SSCKCOOKSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|