C11H19FO3Si — CID 15403702
(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2H-furan-5-one (PubChem CID 15403702) has the molecular formula C11H19FO3Si and a molecular weight of 246.35 g/mol. Its IUPAC name is (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2H-furan-5-one.
| Compound Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2H-furan-5-one |
|---|---|
| PubChem CID | 15403702 |
| Molecular Formula | C11H19FO3Si |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluoro-2H-furan-5-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1C=C(F)C(=O)O1 |
| InChI | InChI=1S/C11H19FO3Si/c1-11(2,3)16(4,5)14-7-8-6-9(12)10(13)15-8/h6,8H,7H2,1-5H3/t8-/m1/s1 |
| InChIKey | SABALVCJTLEHGI-MRVPVSSYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|