C13H22O4Si — CID 140824928
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxypyran-4-one (PubChem CID 140824928) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxypyran-4-one.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxypyran-4-one |
|---|---|
| PubChem CID | 140824928 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methoxypyran-4-one |
| SMILES | COc1coc(CO[Si](C)(C)C(C)(C)C)cc1=O |
| InChI | InChI=1S/C13H22O4Si/c1-13(2,3)18(5,6)17-8-10-7-11(14)12(15-4)9-16-10/h7,9H,8H2,1-6H3 |
| InChIKey | LGKSCNMCFYATPT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|