C30H60O4Si2Sn — CID 58985889
3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-tributylstannylpyran-4-one (PubChem CID 58985889) has the molecular formula C30H60O4Si2Sn and a molecular weight of 659.69 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-tributylstannylpyran-4-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-tributylstannylpyran-4-one |
|---|---|
| PubChem CID | 58985889 |
| Molecular Formula | C30H60O4Si2Sn |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-tributylstannylpyran-4-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1oc(CO[Si](C)(C)C(C)(C)C)cc(=O)c1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H33O4Si2.3C4H9.Sn/c1-17(2,3)23(7,8)21-12-14-11-15(19)16(13-20-14)22-24(9,10)18(4,5)6;3*1-3-4-2;/h11H,12H2,1-10H3;3*1,3-4H2,2H3; |
| InChIKey | GVEGROLQOWYARY-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|