C18H33BrO4Si2 — CID 58985884
2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyran-4-one (PubChem CID 58985884) has the molecular formula C18H33BrO4Si2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyran-4-one.
| Compound Name | 2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyran-4-one |
|---|---|
| PubChem CID | 58985884 |
| Molecular Formula | C18H33BrO4Si2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-bromo-3-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyran-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(=O)c(O[Si](C)(C)C(C)(C)C)c(Br)o1 |
| InChI | InChI=1S/C18H33BrO4Si2/c1-17(2,3)24(7,8)21-12-13-11-14(20)15(16(19)22-13)23-25(9,10)18(4,5)6/h11H,12H2,1-10H3 |
| InChIKey | YKCMGHVUGDROAS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|