C15H26O5Si — CID 172846639
3-[diethoxy(methyl)silyl]propyl 5-methyl-4-oxohexa-2,5-dienoate (PubChem CID 172846639) has the molecular formula C15H26O5Si and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-[diethoxy(methyl)silyl]propyl 5-methyl-4-oxohexa-2,5-dienoate.
| Compound Name | 3-[diethoxy(methyl)silyl]propyl 5-methyl-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 172846639 |
| Molecular Formula | C15H26O5Si |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[diethoxy(methyl)silyl]propyl 5-methyl-4-oxohexa-2,5-dienoate |
| SMILES | C=C(C)C(=O)C=CC(=O)OCCC[Si](C)(OCC)OCC |
| InChI | InChI=1S/C15H26O5Si/c1-6-19-21(5,20-7-2)12-8-11-18-15(17)10-9-14(16)13(3)4/h9-10H,3,6-8,11-12H2,1-2,4-5H3 |
| InChIKey | XMYCMPZOICSATJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|