C25H46O4Si2 — CID 102050112
(2R)-2-[(1E,3E,6R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhepta-1,3-dienyl]-2,3-dihydropyran-6-one (PubChem CID 102050112) has the molecular formula C25H46O4Si2 and a molecular weight of 466.81 g/mol. Its IUPAC name is (2R)-2-[(1E,3E,6R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhepta-1,3-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(1E,3E,6R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhepta-1,3-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 102050112 |
| Molecular Formula | C25H46O4Si2 |
| Molecular Weight | 466.81 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | (2R)-2-[(1E,3E,6R)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhepta-1,3-dienyl]-2,3-dihydropyran-6-one |
| SMILES | CC(/C=C/[C@H]1CC=CC(=O)O1)=C\C[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O4Si2/c1-20(15-17-21-13-12-14-23(26)28-21)16-18-22(29-31(10,11)25(5,6)7)19-27-30(8,9)24(2,3)4/h12,14-17,21-22H,13,18-19H2,1-11H3/b17-15+,20-16+/t21-,22-/m1/s1 |
| InChIKey | NESIXJARZVDLIE-SPOWWAHLSA-N |
| XLogP | 7.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.81 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|